Humantenmine | Synonyms | Gelsenicine |
| Appearance | Solid |
| CAS | 82354-38-9 |
| Purity | 99.65% |
| Molecular Weight | 326.39 |
| Formula | C19H22N2O3 |
| Color | Off-white to light yellow |
| SMILES | O=C1[C@]2([C@H](OC3)C[C@]4([H])[C@@]3([H])[C@@H](N=C4CC)C2)C5=CC=CC=C5N1OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13247 | Cucurbitacin B | Inquiry |
|
| PDP-13210 | Saponins | Inquiry |
|
| PDP-18412 | Gynosaponin I | Inquiry |
|
| PDP-14921 | rel-α-Vitamin E | Inquiry |
|
| PDP-13577 | Sophocarpine | Inquiry |
|
| PDP-15977 | 3,9-Dihydroeucomin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
