Hypocrellin B | CAS No. | 123940-54-5 |
| Purity | 99.61% |
| Molecular Weight | 528.51 |
| Formula | C30H24O9 |
| Appearance | Solid |
| Color | Brown to black |
| SMILES | CC(C1)=C(C(C)=O)C(C2=C(C3=C(O)C=C4OC)C4=C5C(OC)=CC(O)=C6C5=C2C1=C(OC)C6=O)=C(OC)C3=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22246 | Ganolucidic Acid A | Inquiry |
|
| MDP-12355 | Ethyl Palmitate (Standard) | Inquiry |
|
| MDP-21985 | Kagimminol B | Inquiry |
|
| MDP-22028 | UK-2A | Inquiry |
|
| MDP-23065 | Stachartin C | Inquiry |
|
| MDP-11578 | cis-4-Hydroxy-L-proline | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
