Hypocrellin B (Standard) | CAS No. | 123940-54-5 |
| Molecular Weight | 528.51 |
| Formula | C30H24O9 |
| SMILES | CC(C1)=C(C(C)=O)C(C2=C(C3=C(O)C=C4OC)C4=C5C(OC)=CC(O)=C6C5=C2C1=C(OC)C6=O)=C(OC)C3=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12210 | Neosartoricin B | Inquiry |
|
| MDP-12578 | Kalimantacin A | Inquiry |
|
| MDP-12760 | (S)-Licoisoflavone A | Inquiry |
|
| MDP-11100 | Xanthine | Inquiry |
|
| MDP-24245 | Galacardin A | Inquiry |
|
| MDP-12309 | N-Acetyl-L-aspartic Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
