Hythiemoside B | CAS | 853267-90-0 |
| Molecular Weight | 526.66 |
| Formula | C28H46O9 |
| SMILES | C[C@]([C@@](CC1)([H])C2(C)C)(CC[C@H]2O[C@@H]([C@@H]([C@H]3O)O)O[C@@H]([C@H]3O)CO)[C@@](CC4)([H])C1=C[C@@]4(C)[C@H](CO)OC(C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15383 | Benzylacetone | Inquiry |
|
| PDP-17509 | Dihydroisocucurbitacin B | Inquiry |
|
| PDP-20019 | 8-Gingerdione | Inquiry |
|
| PDP-18596 | 8,9-Epoxy-3-isobutyryloxy-10-(2-methylbutanoyl)thymol | Inquiry |
|
| PDP-15793 | 5-Hydroxy-3,7-dimethoxyflavone | Inquiry |
|
| PDP-15670 | Lobelanine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
