Ikarugamycin | CAS No. | 36531-78-9 |
| Purity | ≥99.0% |
| Molecular Weight | 478.62 |
| Formula | C29H38N2O4 |
| Appearance | Solid |
| Color | White to light yellow |
| SMILES | O=C(/C=C/[C@@H]1C[C@]2([C@@]([H])([C@H]1C/C=C\3)C=C[C@@]4([C@@]2(C[C@H]([C@H]4CC)C)[H])[H])[H])C5=C([C@@H](NC5=O)CCCNC3=O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23000 | Antibiotic DC 102 | Inquiry |
|
| MDP-23353 | Aureusimine B | Inquiry |
|
| MDP-22203 | Dopamine (hydrochloride) (Standard) | Inquiry |
|
| MDP-12395 | L-Homocysteine (Standard) | Inquiry |
|
| MDP-23951 | Fibrostatin F | Inquiry |
|
| MDP-22284 | Acarbose (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
