Ingol 7,8,12-triacetate 3-phenylacetate | CAS | 944799-46-6 |
| Molecular Weight | 596.66 |
| Formula | C33H40O10 |
| SMILES | C/C([C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@](C1(C)C)([H])[C@@]1([H])[C@@H](OC(C)=O)[C@H]2C)=C\[C@@]3(O4)[C@]4(C[C@H](C)[C@@H]3OC(C5=CC=CC=C5)=O)C2=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19590 | 6-Dehydrogingerdione | Inquiry |
|
| PDP-18269 | Casegravol | Inquiry |
|
| PDP-13754 | Bergaptol | Inquiry |
|
| PDP-20024 | Entagenic Acid | Inquiry |
|
| PDP-16712 | Cepharanone B | Inquiry |
|
| PDP-17750 | Fulvotomentoside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
