Ipecoside | Appearance | Solid |
| CAS | 15401-60-2 |
| Purity | 98.38% |
| Molecular Weight | 565.57 |
| Formula | C27H35NO12 |
| Color | Off-white to light yellow |
| SMILES | O=C(C1=CO[C@@H](O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)[C@H](C=C)[C@@H]1C[C@H]3N(C(C)=O)CCC4=C3C=C(O)C(O)=C4)OC |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15454 | 4-Methyl-5,6,7,8-tetrahydroquinoline | Inquiry |
|
| PDP-16448 | O-Methyldauricine | Inquiry |
|
| PDP-15129 | Carabrone | Inquiry |
|
| PDP-17434 | Denudaquinol | Inquiry |
|
| PDP-17221 | Vibsanin A | Inquiry |
|
| PDP-20014 | Cinchonine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
