Iristectorigenin B | Synonyms | Iristectrigenin B |
| Appearance | Solid |
| CAS | 86849-77-6 |
| Purity | 99.49% |
| Molecular Weight | 330.29 |
| Formula | C17H14O7 |
| Color | Off-white to yellow |
| SMILES | O=C1C2=C(O)C(OC)=C(O)C=C2OC=C1C3=CC(O)=C(OC)C=C3 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19363 | Sodium New Houttuyfonate | Inquiry |
|
| PDP-14663 | Chinese Gallotannin | Inquiry |
|
| PDP-15298 | Ergolide | Inquiry |
|
| PDP-14390 | Diallyl Disulfide | Inquiry |
|
| PDP-19077 | 1,2,3-Tri-O-methyl-7,8-methyleneflavellagic Acid | Inquiry |
|
| PDP-16261 | Shizukaol A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
