Isatropolone A | CAS No. | 2097813-40-4 |
| Molecular Weight | 456.44 |
| Formula | C24H24O9 |
| SMILES | O=C(C=C1C2=C3OC(C)=CC2=C(C1=O)C(CCC)=O)C4=C3O[C@]5([C@@]4([C@@H]([C@@H]([C@H](O5)C)OC)O)O)[H] |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11733 | Levulinic Acid | Inquiry |
|
| MDP-24370 | Acetoacetic Acid | Inquiry |
|
| MDP-24345 | Octacosamicin B | Inquiry |
|
| MDP-23906 | Chicamycin B | Inquiry |
|
| MDP-11666 | Salicyl Alcohol | Inquiry |
|
| MDP-22621 | Desmosterol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
