Isocucurbitacin B | CAS | 17278-28-3 |
| Molecular Weight | 558.70 |
| Formula | C32H46O8 |
| SMILES | C[C@]12[C@@]([C@]([C@@](C)(O)C(/C=C/C(C)(C)OC(C)=O)=O)([H])[C@H](O)C1)(CC([C@]3(C)[C@@]2([H])CC=C4[C@@]3([H])CC([C@@H](O)C4(C)C)=O)=O)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15273 | Naringenin Triacetate | Inquiry |
|
| PDP-15109 | 4-Methylsyringol | Inquiry |
|
| PDP-16136 | Ilexoside D | Inquiry |
|
| PDP-15923 | Methyl Myristate | Inquiry |
|
| PDP-20553 | Isoorientin (Standard) | Inquiry |
|
| PDP-16672 | 1,2,3,6-Tetragalloylglucose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
