Isodihydrofutoquinol B | CAS | 62499-71-2 |
| Molecular Weight | 356.41 |
| Formula | C21H24O5 |
| SMILES | C[C@@H]([C@]1(C(OC)=CC(C(CC=C)=C1)=O)OC)CC2=CC=C(OCO3)C3=C2 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17660 | Piscidic Acid | Inquiry |
|
| PDP-19310 | Hosenkoside M | Inquiry |
|
| PDP-15393 | Soyasaponin Ba | Inquiry |
|
| PDP-15257 | Nodakenetin | Inquiry |
|
| PDP-19956 | Decursinol (Standard) | Inquiry |
|
| PDP-13671 | Picrotoxinin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
