Isohyenanchin | Synonyms | Hydroxycoriatin |
| CAS | 19417-00-6 |
| Molecular Weight | 312.32 |
| Formula | C15H20O7 |
| SMILES | C[C@]12[C@@]3(CO3)[C@H](O4)[C@H]4[C@]1([C@]5([H])C(C(C)(O)C)([H])[C@](OC5=O)([H])[C@H]2O)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20244 | 5-O-beta-D-Glucopyranosylmyricanol | Inquiry |
|
| PDP-15283 | Ciwujianoside C3 | Inquiry |
|
| PDP-15258 | Lirinidine | Inquiry |
|
| PDP-19499 | Vincamine (Standard) | Inquiry |
|
| PDP-17977 | Ajmalicine Hydrochloride | Inquiry |
|
| PDP-15105 | 7-Methoxyrosmanol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
