Isomalt | Synonyms | Palatinitol |
| Appearance | Solid |
| CAS | 64519-82-0 |
| Purity | ≥98.0% |
| Molecular Weight | 688.62 |
| Formula | C24H48O22 |
| Color | White to off-white |
| SMILES | OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO[C@@H](O1)[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO.O[C@H]([C@@H](CO[C@H]([C@@H]([C@@H](O)[C@@H]2O)O)O[C@@H]2CO)O)[C@H](O)[C@@H](CO)O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15291 | Isofebrifugine | Inquiry |
|
| PDP-16828 | 5,7-Diacetoxy-8-methoxyflavone | Inquiry |
|
| PDP-19831 | Macranthoidin B (Standard) | Inquiry |
|
| PDP-18911 | 4'-O-Methylnyasol | Inquiry |
|
| PDP-16089 | Chloramultilide B | Inquiry |
|
| PDP-15016 | Bruceine B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
