(+)-Isomenthone | Appearance | Liquid (Density: 0.881±0.06 g/cm3) |
| CAS | 1196-31-2 |
| Purity | ≥98.0% |
| Molecular Weight | 154.25 |
| Formula | C10H18O |
| Color | Colorless to light yellow |
| SMILES | O=C1[C@@H](C(C)C)CC[C@@H](C)C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19384 | Pterisolic Acid A | Inquiry |
|
| PDP-14457 | Moracin C | Inquiry |
|
| PDP-18906 | 4-O-Methylbutein | Inquiry |
|
| PDP-16028 | Chloranthalactone B | Inquiry |
|
| PDP-17338 | Methyl Diacetoxy-6-gingerdiol | Inquiry |
|
| PDP-19238 | Hentriacontane | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
