Isorhamnetin (Standard) | Synonyms | 3'-Methylquercetin (Standard) |
| CAS | 480-19-3 |
| Molecular Weight | 316.26 |
| Formula | C₁₆H₁₂O₇ |
| SMILES | O=C1C(O)=C(C2=CC=C(O)C(OC)=C2)OC3=CC(O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19822 | Alisol B (Standard) | Inquiry |
|
| PDP-13043 | Rhodiola Rosea Extract | Inquiry |
|
| PDP-17977 | Ajmalicine Hydrochloride | Inquiry |
|
| PDP-17704 | Kadsurenin A | Inquiry |
|
| PDP-14711 | Furanodienone | Inquiry |
|
| PDP-14579 | Podophyllotoxin Glucoside | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
