Isorubrofusarin-6-O-β-gentiobioside | Synonyms | Isorubrofusarin Gentiobioside |
| CAS | 200127-93-1 |
| Molecular Weight | 596.53 |
| Formula | C27H32O15 |
| SMILES | OC1=C2C(OC(C)=CC2=O)=C3C(O[C@@H]([C@@H]([C@H]4O)O)O[C@@H]([C@H]4O)CO[C@@H]([C@@H]([C@H]5O)O)O[C@@H]([C@H]5O)CO)=CC(OC)=CC3=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18650 | 9,10-Dimethoxycanthin-6-one | Inquiry |
|
| PDP-15419 | Mangiferin (Standard) | Inquiry |
|
| PDP-18278 | Cimiside B | Inquiry |
|
| PDP-20536 | Ginsenoside Rh1 (Standard) | Inquiry |
|
| PDP-16594 | (Rac)-Anemonin | Inquiry |
|
| PDP-13198 | Ginsenoside Rb1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
