Jangomolide | CAS | 93767-25-0 |
| Molecular Weight | 468.50 |
| Formula | C26H28O8 |
| SMILES | C[C@@]12CCC3[C@](C(CC4[C@]35C=CC(OC5OC4(C)C)=O)=O)(C)[C@@]16C(C(OC2C7=COC=C7)=O)O6 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17539 | 5,7,8,3',4',5'-Hexamethoxyflavone | Inquiry |
|
| PDP-15512 | Maackiain | Inquiry |
|
| PDP-18830 | Sterebin A | Inquiry |
|
| PDP-17990 | Ganolactone B | Inquiry |
|
| PDP-15743 | Methyl Deacetylasperulosidate | Inquiry |
|
| PDP-15925 | Lyciumin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
