Jionoside A1 | CAS | 120444-60-2 |
| Molecular Weight | 800.75 |
| Formula | C36H48O20 |
| SMILES | COC1=C(O)C=CC(/C=C/C(O[C@H]2[C@@H]([C@H]([C@H](OCCC3=CC(O)=C(O)C=C3)O[C@@H]2CO[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)CO)O)O[C@@]5([H])[C@@H]([C@@H]([C@@H](O)[C@H](C)O5)O)O)=O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16471 | Crocin (Standard) | Inquiry |
|
| PDP-18298 | Cuniloside B | Inquiry |
|
| PDP-19301 | Blepharotriol | Inquiry |
|
| PDP-12979 | Citrus Aurantium Extract, 98.0% | Inquiry |
|
| PDP-15039 | Rebaudioside E | Inquiry |
|
| PDP-13891 | Beta-Sitosterol (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
