Jujuboside B (Standard) | CAS | 55466-05-2 |
| Molecular Weight | 1045.21 |
| Formula | C52H84O21 |
| SMILES | C[C@]([C@]1([H])CC2)(CC[C@]3([H])[C@@]1(CC[C@H](O[C@@](OC[C@H](O)[C@@H]4O[C@@](O[C@H](CO)[C@@H](O)[C@@H]5O)([H])[C@@H]5O[C@@](OC[C@@H](O)[C@@H]6O)([H])[C@@H]6O)([H])[C@@H]4O[C@@](O[C@@H](C)[C@H](O)[C@H]7O)([H])[C@@H]7O)C3(C)C)C)[C@@]8(CO9)[C@@]2([H])[C@]([C@]%10(O)C)([H])[C@@]9(O[C@@H](/C=C(C)/C)C%10)C8 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14620 | Polygalasaponin F | Inquiry |
|
| PDP-14930 | Vanillin (Standard) | Inquiry |
|
| PDP-16618 | Forskolin G | Inquiry |
|
| PDP-14357 | Salvianolic Acid Y | Inquiry |
|
| PDP-13867 | Zerumbone | Inquiry |
|
| PDP-16033 | Toxicarol Isoflavone | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.