Kaempferol-3-O-[(6-caffeoyl)-β-glucopyranosyl (1→3) α-rhamnopyranoside]-7-O-α-rhamnopyranoside | CAS | 1459767-45-3 |
| Molecular Weight | 902.80 |
| Formula | C42H46O22 |
| SMILES | O=C(C(O[C@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)C)O)O[C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)COC(/C=C/C3=CC(O)=C(C=C3)O)=O)O)=C(C4=CC=C(C=C4)O)OC5=CC(O[C@H]6[C@@H]([C@@H]([C@H]([C@@H](O6)C)O)O)O)=C7)C5=C7O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19035 | 12E,14-Labdadien-20,8β-olide | Inquiry |
|
| PDP-15428 | 4(3H)-Quinazolinone | Inquiry |
|
| PDP-20352 | Xanthiside | Inquiry |
|
| PDP-17963 | 20-Deoxyingenol 3-angelate | Inquiry |
|
| PDP-15203 | (Rac)-Shikonin | Inquiry |
|
| PDP-17618 | Cnidioside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
