Kalafungin | CAS No. | 11048-15-0 |
| Synonyms | Kalamycin; U-19718 |
| Molecular Weight | 300.26 |
| Formula | C16H12O6 |
| SMILES | O=C1C2=C([C@H](O[C@@](C3)([H])[C@]2([H])OC3=O)C)C(C4=C(O)C=CC=C14)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12385 | trans,trans-2,4-Decadienal | Inquiry |
|
| MDP-24330 | Elaiomycin | Inquiry |
|
| MDP-23810 | Ferensimycin B | Inquiry |
|
| MDP-12129 | Protoporphyrin IX (Standard) | Inquiry |
|
| MDP-12567 | Napyradiomycin A1 | Inquiry |
|
| MDP-12108 | Maltononaose | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
