Kansenone | CAS | 543691-16-3 |
| Molecular Weight | 440.70 |
| Formula | C30H48O2 |
| SMILES | C[C@@]12C3=C(CC[C@]1([C@](CC2)([H])[C@H](C)CC/C=C(C)\C)C)[C@@]4([C@@](C(C)([C@H](CC4)O)C)([H])CC3=O)C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18366 | Eucalyptin | Inquiry |
|
| PDP-18282 | Cnidioside B Methyl Ester | Inquiry |
|
| PDP-15839 | Swertiajaponin | Inquiry |
|
| PDP-16479 | Neocryptomerin | Inquiry |
|
| PDP-19813 | Phellodendrine Chloride (Standard) | Inquiry |
|
| PDP-15614 | Macranthoside B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
