Kimcuongin | CAS | 1872403-23-0 |
| Molecular Weight | 356.37 |
| Formula | C20H20O6 |
| SMILES | C/C(C)=C\C(O/C(C(C1=C(O2)C(C=CC2=O)=CC=C1OC)=O)=C(C)\C)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17669 | Resveratrol-4'-O-(6"-O-galloyl)-glucopyranoside | Inquiry |
|
| PDP-15630 | Fructo-oligosaccharide DP8/GF7 | Inquiry |
|
| PDP-14643 | DL-Menthol | Inquiry |
|
| PDP-18210 | Liriodendrin | Inquiry |
|
| PDP-15416 | Dalbergin | Inquiry |
|
| PDP-17402 | Withasomniferolide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
