Kinamycin B | CAS No. | 35303-13-0 |
| Molecular Weight | 412.35 |
| Formula | C20H16N2O8 |
| SMILES | O=C1C2=CC=CC(O)=C2C(C(C3=[N+]=[N-])=C1C4=C3[C@@H](O)[C@@](C)(OC(C)=O)[C@H](O)[C@H]4O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23132 | Saframycin S | Inquiry |
|
| MDP-12675 | Epicoccone B | Inquiry |
|
| MDP-12638 | Mycestericin C | Inquiry |
|
| MDP-12127 | Benzoic Acid (Standard) | Inquiry |
|
| MDP-24111 | Feigrisolide D | Inquiry |
|
| MDP-22205 | Monascin (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
