Kushenol M | CAS | 101236-51-5 |
| Molecular Weight | 508.60 |
| Formula | C30H36O7 |
| SMILES | C/C(C)=C\C[C@@H](C(C)=C)CC1=C2C(C([C@@H]([C@@H](C3=C(C=C(C=C3)O)O)O2)O)=O)=C(C(C/C=C(C)\C)=C1O)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19185 | Hancinone | Inquiry |
|
| PDP-18231 | Kaempferol 3-O-arabinoside | Inquiry |
|
| PDP-18280 | Cleroindicin B | Inquiry |
|
| PDP-18903 | Yadanziolide B | Inquiry |
|
| PDP-17685 | Polyfuroside | Inquiry |
|
| PDP-13505 | alpha-Hederin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
