L-Linalool (Standard) | Appearance | Liquid |
| CAS | 126-91-0 |
| Purity | 98.10% |
| Molecular Weight | 154.25 |
| Formula | C10H18O |
| Color | Colorless to light yellow |
| SMILES | C=C[C@@](C)(CC/C=C(C)/C)O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17501 | 23-Epi-26-deoxycimicifugoside | Inquiry |
|
| PDP-15624 | Ferruginol | Inquiry |
|
| PDP-18925 | α-Cembrenediol | Inquiry |
|
| PDP-13230 | Dicoumarol | Inquiry |
|
| PDP-18175 | Methyl-3-(2,4-dihydroxy Phenyl) Propanoate | Inquiry |
|
| PDP-18004 | Guvacine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
