Lactucin | Appearance | Solid |
| CAS | 1891-29-8 |
| Purity | 99.72% |
| Molecular Weight | 276.28 |
| Formula | C15H16O5 |
| Color | Off-white to light yellow |
| SMILES | OCC([C@]1([H])[C@]2([H])[C@]([C@H](CC(C)=C13)O)([H])C(C(O2)=O)=C)=CC3=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, sealed storage, away from moisture and light In solvent: -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15515 | Diosbulbin B | Inquiry |
|
| PDP-16921 | Decuroside I | Inquiry |
|
| PDP-16835 | 1(10)-Aristolen-2-one | Inquiry |
|
| PDP-15147 | Yohimbic Acid | Inquiry |
|
| PDP-14246 | Kahweol | Inquiry |
|
| PDP-14081 | Alisol A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
