Lagosin | CAS No. | 6834-98-6 |
| Synonyms | Fungichromin; Pentamycin; Cogomycin |
| Molecular Weight | 670.83 |
| Formula | C35H58O12 |
| Appearance | Solid |
| Color | Light yellow to yellow |
| SMILES | CCCCC[C@H]([C@]1([H])[C@H](C[C@H](C[C@H](C[C@H](C[C@H](C[C@H]([C@H]([C@@H](/C(C)=C/C=C/C=C/C=C/C=C/[C@@H]([C@H](OC1=O)C)O)O)O)O)O)O)O)O)O)O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22151 | Salinosporamide C | Inquiry |
|
| MDP-11443 | (E)-Ferulic Acid | Inquiry |
|
| MDP-22095 | Formycin B | Inquiry |
|
| MDP-11181 | Kuromanin Chloride | Inquiry |
|
| MDP-11800 | 3-Hydroxypyridine | Inquiry |
|
| MDP-23990 | Cymbimicin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
