Laxiflorin B | CAS | 165337-71-3 |
| Molecular Weight | 344.40 |
| Formula | C20H24O5 |
| SMILES | O=C1[C@]2(COC([C@]3(C4=O)[C@@]2([H])CC[C@@H](C4=C)C3)=O)[C@H](CO)C(C)(C)C=C1 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20243 | Aloinoside A | Inquiry |
|
| PDP-14163 | Prunasin | Inquiry |
|
| PDP-17780 | Peimisine 3-O-β-D-glucopyranoside | Inquiry |
|
| PDP-14176 | 5,7,4'-Trimethoxyflavone | Inquiry |
|
| PDP-17853 | Heteroclitin A | Inquiry |
|
| PDP-14833 | Acacetin 7-O-glucuronide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
