Leojaponin | CAS | 864817-63-0 |
| Molecular Weight | 314.42 |
| Formula | C20H26O3 |
| SMILES | C[C@@]12C(C(C)(CCC1)C)=C(C(C(C)=C2CCC3=COC=C3)=O)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14141 | Rauwolscine Hydrochloride | Inquiry |
|
| PDP-14946 | ar-Turmerone | Inquiry |
|
| PDP-19068 | Eupaglehnin C | Inquiry |
|
| PDP-18765 | 7-Xylosyl-10-Deacetyltaxol B | Inquiry |
|
| PDP-14878 | 5,15-Diacetyl-3-benzoyllathyrol | Inquiry |
|
| PDP-19014 | Monomethyl Lithospermate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
