Lepidiline A | Appearance | Solid |
| CAS | 596093-98-0 |
| Purity | 99.87% |
| Molecular Weight | 312.84 |
| Formula | C19H21ClN2 |
| Color | White to off-white |
| SMILES | CC1=C(C)[N+](CC2=CC=CC=C2)=CN1CC3=CC=CC=C3.[Cl-] |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17170 | Angustifoline Hydrochloride | Inquiry |
|
| PDP-15183 | (±)-Dihydrozeatin | Inquiry |
|
| PDP-20382 | Cryptomoscatone D2 | Inquiry |
|
| PDP-19343 | (+)-Schisandrin B | Inquiry |
|
| PDP-17601 | Ekersenin | Inquiry |
|
| PDP-19476 | Farobin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
