Leptofuranin B | CAS No. | 183017-81-4 |
| Molecular Weight | 526.75 |
| Formula | C33H50O5 |
| SMILES | CC(C=CC(O1)=O)C1/C=C/C(CC)=C\C(C)C/C=C/C(C)=C/C(C)C(C(C2OC(C)(CC2C)CCO)C)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12022 | Creatinine (Standard) | Inquiry |
|
| MDP-24174 | Epelmycin A | Inquiry |
|
| MDP-23248 | D-Phenylalanine (Standard) | Inquiry |
|
| MDP-11680 | Moniliformin Sodium Salt | Inquiry |
|
| MDP-23454 | Alliacol B | Inquiry |
|
| MDP-22840 | Sambutoxin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
