Leucinostatin H | CAS No. | 109539-58-4 |
| Molecular Weight | 1134.49 |
| Formula | C57H103N11O12 |
| SMILES | O=C(N[C@H](C[N+](C)(C)[O-])C)CCNC(C(C)(C)NC(C(C)(C)NC([C@H](CC(C)C)NC([C@H](CC(C)C)NC(C(C)(C)NC([C@H]([C@H](O)C(C)C)NC([C@H](CC(C)C)NC([C@@H]1C[C@@H](CN1C(/C=C/[C@@H](C)CC)=O)C)=O)=O)=O)=O)=O)=O)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11558 | 2,4-Di-tert-butylphenol | Inquiry |
|
| MDP-23118 | 2-C-Methyl-D-erythritol 4-phosphate | Inquiry |
|
| MDP-23189 | Salicylamide (Standard) | Inquiry |
|
| MDP-12474 | Benzomalvin B | Inquiry |
|
| MDP-24192 | Epelmycin C | Inquiry |
|
| MDP-22967 | Rhizopodin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
