Leuseramycin | CAS No. | 73537-10-7 |
| Synonyms | TM-531A |
| Molecular Weight | 851.11 |
| Formula | C47H78O13 |
| SMILES | C[C@@H]([C@@H]1O[C@@]2(CC[C@@](C)(O2)[C@@H]3C[C@@H](O[C@@H]4O[C@@H]([C@@H](CC4)OC)C)[C@@H]([C@@]5(O[C@@H](C[C@@H]5C)[C@@H]6[C@@H](C)C[C@@H]([C@@](C)(O)O6)C)O3)C)C[C@@H]([C@@H]1C)O)/C=C(C)/C([C@@H](C)C[C@@H](C)C(O)=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11328 | Citraconic Acid | Inquiry |
|
| MDP-23935 | Mniopetal B | Inquiry |
|
| MDP-23520 | Auramycin B | Inquiry |
|
| MDP-23989 | Cycloepoxydon | Inquiry |
|
| MDP-12343 | Cytosine (Standard) | Inquiry |
|
| MDP-24354 | (S)-b-aminoisobutyric Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
