Levomenol | Synonyms | (-)-α-Bisabolol |
| Appearance | Liquid (Density: 0.9211 g/cm3) |
| CAS | 23089-26-1 |
| Purity | 99.22% |
| Molecular Weight | 222.37 |
| Formula | C15H26O |
| Color | Colorless to light yellow |
| SMILES | C[C@@](O)([C@@]1([H])CCC(C)=CC1)CC/C=C(C)/C |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Pure form -20°C 3 years; 4°C 2 years In solvent: -80°C 6 months; -20°C 1 month |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15664 | Ardisiacrispin B | Inquiry |
|
| PDP-17028 | Esculentoside C | Inquiry |
|
| PDP-13470 | Periplocin | Inquiry |
|
| PDP-20336 | Methyl Laurate (Standard) | Inquiry |
|
| PDP-14084 | Retrorsine | Inquiry |
|
| PDP-12984 | Alpha Lipoic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
