Licochalcone B (Standard) | CAS | 58749-23-8 |
| Molecular Weight | 286.28 |
| Formula | C16H14O5 |
| SMILES | O=C(C1=CC=C(O)C=C1)/C=C/C2=CC=C(O)C(O)=C2OC |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19627 | OAT1/3-IN-1 | Inquiry |
|
| PDP-17595 | 4,5-Dioxodehydroasimilobine | Inquiry |
|
| PDP-18841 | Dehydrocurdione | Inquiry |
|
| PDP-18249 | Isodunnianol | Inquiry |
|
| PDP-20225 | Nyasicoside | Inquiry |
|
| PDP-20020 | Tuberostemonine D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
