Licoflavone B | Appearance | Solid |
| CAS | 91433-17-9 |
| Purity | 99.91% |
| Molecular Weight | 390.47 |
| Formula | C25H26O4 |
| Color | White to yellow |
| SMILES | O=C1C=C(C2=CC=C(O)C(C/C=C(C)\C)=C2)OC3=CC(O)=C(C/C=C(C)\C)C=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18862 | Bacopaside IV | Inquiry |
|
| PDP-17156 | Physalin O | Inquiry |
|
| PDP-19446 | (E)-4-(3,4-Dimethoxyphenyl)but-3-ene-1,2-diol | Inquiry |
|
| PDP-13456 | Fagomine | Inquiry |
|
| PDP-16215 | Angoline Hydrochloride | Inquiry |
|
| PDP-17974 | Dehydromaackiain | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.