Licorisoflavan A | Synonyms | 7-O-Methyllicorisoflavan B |
| CAS | 129314-37-0 |
| Molecular Weight | 438.56 |
| Formula | C27H34O5 |
| SMILES | COC1=C2C(OC[C@@H](C3=C(C(C/C=C(C)/C)=C(O)C=C3)O)C2)=CC(OC)=C1C/C=C(C)/C |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19773 | Mogroside V (Standard) | Inquiry |
|
| PDP-16463 | (Rac)-Hydnocarpin | Inquiry |
|
| PDP-15535 | Torachrysone-8-O-b-D-glucoside | Inquiry |
|
| PDP-16979 | Secologanate | Inquiry |
|
| PDP-18098 | Piperlotine C | Inquiry |
|
| PDP-17134 | (Rac)-Myrislignan | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
