Ligupurpuroside B | CAS | 147396-02-9 |
| Molecular Weight | 738.73 |
| Formula | C35H46O17 |
| SMILES | OC(C(OCCC1=CC=C(O)C=C1)O2)C(C(C2CO)OC(/C=C/C3=CC=C(O)C=C3)=O)OC(OC(C)C(OC(OC(C)C(O)C4O)C4O)C5O)C5O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16876 | Isocudraniaxanthone B | Inquiry |
|
| PDP-15035 | Hydroxytyrosol Acetate | Inquiry |
|
| PDP-19519 | Coretinphencone | Inquiry |
|
| PDP-18861 | Achyranthoside C | Inquiry |
|
| PDP-17574 | Selaginellin I | Inquiry |
|
| PDP-17677 | Neochilenin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
