Ligupurpuroside C | CAS | 1194056-33-1 |
| Molecular Weight | 738.73 |
| Formula | C35H46O17 |
| SMILES | O[C@H]([C@H]1COC(/C=C/C2=CC=C(O)C=C2)=O)[C@@H]([C@H]([C@H](OCCC3=CC=C(O)C=C3)O1)O)O[C@@](O[C@@H](C)[C@H](O[C@@](O[C@@H](C)[C@H](O)[C@H]4O)([H])[C@@H]4O)[C@H]5O)([H])[C@@H]5O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15903 | Tropone | Inquiry |
|
| PDP-13199 | Withaferin A | Inquiry |
|
| PDP-19183 | Ethyl Brevifolincarboxylate | Inquiry |
|
| PDP-18481 | Perisesaccharide B | Inquiry |
|
| PDP-15000 | (+)-Glaucarubinone | Inquiry |
|
| PDP-17050 | Laurycolactone A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
