Linearmycin B | CAS No. | 182291-65-2 |
| Molecular Weight | 1166.52 |
| Formula | C66H103NO16 |
| SMILES | O=C(O)/C(C)=C/C=C/C=C/C=C/C=C/CC/C=C/C(C)C(O)C(C)C(O)/C=C/C=C/C=C/C=C/C=C/CC(O)C(C)C(CC(O)CC(O)CC(O)/C=C/CC(O)CC(O)CC(O)CC(O)/C=C/CC(O)/C=C/CC(O)CC(O)CCCN)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11592 | 2'-Deoxyadenosine-5'-monophosphate | Inquiry |
|
| MDP-12727 | Axinelline A | Inquiry |
|
| MDP-11240 | 2-Hydroxybutyric Acid | Inquiry |
|
| MDP-11410 | Avermectin B1 | Inquiry |
|
| MDP-22604 | Feudomycin B | Inquiry |
|
| MDP-11451 | Lipoteichoic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
