Linoleamide (Standard) | CAS No. | 3999-01-7 |
| Molecular Weight | 279.46 |
| Formula | C18H33NO |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(N)=O |
| Intended Use | For research use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23829 | 2,3-Butanediol (Standard) | Inquiry |
|
| MDP-11684 | N-Decanoyl-L-homoserine Lactone | Inquiry |
|
| MDP-24250 | Resorcinomycin B | Inquiry |
|
| MDP-12643 | Agonodepside B | Inquiry |
|
| MDP-22471 | 9-Ethyladenine (Standard) | Inquiry |
|
| MDP-22457 | Thermospermine (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
