Linoleic Acid | CAS No. | 60-33-3 |
| Purity | 99.92% |
| Molecular Weight | 280.45 |
| Formula | C18H32O2 |
| Appearance | Liquid (Density: 0.902 g/cm3) |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
-20°C, protect from light, stored under nitrogen In solvent: -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22895 | Cochlioquinone B | Inquiry |
|
| MDP-23703 | Granaticin | Inquiry |
|
| MDP-23444 | Andrastin B | Inquiry |
|
| MDP-11603 | Aurachin D | Inquiry |
|
| MDP-23518 | Adiposin | Inquiry |
|
| MDP-22000 | 2,3-Dihydrocalodenin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
