Lithospermoside (Standard) | CAS | 63492-69-3 |
| Molecular Weight | 329.30 |
| Formula | C14H19NO8 |
| SMILES | O[C@@H]1[C@@](/C(C=C[C@H]1O)=C\C#N)([H])O[C@@H]([C@@H]([C@@H](O)[C@@H]2O)O)O[C@@H]2CO |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15863 | Sagittatoside B | Inquiry |
|
| PDP-19731 | Cyasterone (Standard) | Inquiry |
|
| PDP-15531 | (3β)-3-Hydroxyoleanan-12-one | Inquiry |
|
| PDP-18051 | 7-O-Isopentenyl-γ-fagarine | Inquiry |
|
| PDP-17611 | 7-Methoxy Obtusifolin | Inquiry |
|
| PDP-18678 | Gomisin E | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
