Lobetyol | CAS | 136171-87-4 |
| Molecular Weight | 234.29 |
| Formula | C14H18O3 |
| SMILES | C/C=C/C#CC#CC(O)C(O)/C=C/CCCO |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15742 | Griffonilide | Inquiry |
|
| PDP-17347 | (+)-6-(3-Chloro-2-hydroxy-3-methylbutyl)-5,7-dimethoxycoumarin | Inquiry |
|
| PDP-16245 | Chalepensin | Inquiry |
|
| PDP-14573 | Leachianone A | Inquiry |
|
| PDP-14278 | Corynoxine B | Inquiry |
|
| PDP-13223 | Salvianolic Acid C | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
