Lucenin 3 | CAS | 12656-83-6 |
| Molecular Weight | 580.49 |
| Formula | C26H28O15 |
| SMILES | OC1=C([C@@H]2O[C@@H]([C@H]([C@@H]([C@H]2O)O)O)CO)C(O)=C(C(C=C(C3=CC(O)=C(C=C3)O)O4)=O)C4=C1[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-20425 | Praeruptorin B (Standard) | Inquiry |
|
| PDP-14814 | 2-Amino-4-methoxyphenol | Inquiry |
|
| PDP-18321 | δ-Amyrin Acetate | Inquiry |
|
| PDP-20423 | Sarsasapogenin (Standard) | Inquiry |
|
| PDP-17385 | Chloranthalactone E | Inquiry |
|
| PDP-18871 | Dehydrobruceine A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
