Lucidenic Acid F | CAS No. | 98665-18-0 |
| Molecular Weight | 456.57 |
| Formula | C27H36O6 |
| SMILES | C[C@H](CCC(O)=O)[C@H]([C@]1(C2)C)CC([C@@]1(C)C(C(C[C@@]3([H])C(C)(C)C(CC[C@]43C)=O)=O)=C4C2=O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23990 | Cymbimicin B | Inquiry |
|
| MDP-22842 | Phyllostine | Inquiry |
|
| MDP-11766 | Lyso-PAF C-16 | Inquiry |
|
| MDP-12131 | Linoleamide | Inquiry |
|
| MDP-23434 | Amycin B | Inquiry |
|
| MDP-22907 | Tetraacetylphytosphingosine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
