Lucidone B | CAS No. | 97653-93-5 |
| Molecular Weight | 400.51 |
| Formula | C24H32O5 |
| SMILES | C[C@@]([C@@](C(C)1C)([H])C2)(CCC1=O)C(C(C[C@@]3([C@H]4C(C)=O)C)=O)=C([C@H]2O)[C@@]3(C(C4)=O)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24297 | Phenylpyropene B | Inquiry |
|
| MDP-12691 | Ganodermaones B | Inquiry |
|
| MDP-24305 | Galactostatin | Inquiry |
|
| MDP-22532 | Aquayamycin | Inquiry |
|
| MDP-11582 | Cyclo(Ala-Gly) | Inquiry |
|
| MDP-11783 | 9-Ethyladenine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
