Lycopsamine (Standard) | CAS | 10285-07-1 |
| Molecular Weight | 299.36 |
| Formula | C15H25NO5 |
| SMILES | C[C@H](O)[C@](C(C)C)(O)C(OCC1=CCN2[C@@]1([H])[C@H](O)CC2)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14206 | L-Canaline | Inquiry |
|
| PDP-13816 | 1,3,6-Tri-O-galloyl-beta-D-glucose | Inquiry |
|
| PDP-18483 | Periplocoside M | Inquiry |
|
| PDP-17429 | Lettowienolide | Inquiry |
|
| PDP-20181 | Bayogenin (Standard) | Inquiry |
|
| PDP-17664 | Eudebeiolide B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
