Lynamicin B | CAS No. | 861149-19-1 |
| Molecular Weight | 458.72 |
| Formula | C22H14Cl3N3O2 |
| SMILES | COC(C1=C(C(C2=CNC3=C2C=C(C(Cl)=C3)Cl)=CN1)C4=CNC5=C4C=C(C=C5)Cl)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12557 | Trichodecenin II | Inquiry |
|
| MDP-24311 | Kerriamycin A | Inquiry |
|
| MDP-23249 | 2-Naphthol (Standard) | Inquiry |
|
| MDP-23742 | Griseolutein B | Inquiry |
|
| MDP-12098 | Ganodermanontriol | Inquiry |
|
| MDP-22936 | 10-Methyldodec-2-en-4-olide | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
